Source code for sciris.sc_printing

"""
Printing/notification functions.

Highlights:
    - :func:`sc.heading() <heading>`: print text as a 'large' heading
    - :func:`sc.colorize() <colorize>`: print text in a certain color
    - :func:`sc.pr() <pr>`: print full representation of an object, including methods and each attribute
    - :func:`sc.sigfig() <sigfig>`: truncate a number to a certain number of significant figures
    - :func:`sc.progressbar() <progressbar>`: show a (text-based) progress bar
    - :func:`sc.capture() <capture>`: capture text output (e.g., stdout) as a variable
"""

import io
import os
import sys
import types
import time
import tqdm
import pprint
import inspect
import warnings
import numpy as np
import collections as co
from textwrap import fill
from contextlib import redirect_stdout
import sciris as sc
import sciris.sc_utils as scu
from ._extras import ansicolors as ansi

# Add Windows support for colors (do this at the module level so that colorama.init() only gets called once)
if sc.iswindows(): # pragma: no cover
    try:
        import colorama
        colorama.init()
        ansi_support = True
    except:
        ansi_support = False
else:
    ansi_support = True


#%% Object display functions

__all__ = ['ansi', 'createcollist', 'objectid', 'classatt', 'objatt', 'objmeth', 'objprop',
           'objrepr', 'prepr', 'pr', 'prettyobj', 'quickobj']

_ncol = 3 # Default number of columns to display
_strlen = 22 # Default string length for a 3-column display
_dividerlen = 72 # Length of the divider between printed sections

[docs] def createcollist(items, title=None, strlen=_strlen, ncol=_ncol): """ Creates a string for a nice columnated list (e.g. to use in __repr__ method) """ if len(items): nrow = int(np.ceil(float(len(items))/ncol)) newkeys = [] for x in range(nrow): newkeys += items[x::nrow] string = title + ':' if title else '' c = 0 for x in newkeys: if c%ncol == 0: string += '\n ' if len(x) > strlen: x = x[:strlen-3] + '...' string += '%-*s ' % (strlen,x) c += 1 string += '\n' else: string = '' return string
[docs] def objectid(obj, showclasses=False): """ Return the object ID as per the default Python ``__repr__`` method *New in version 3.1.0:* "showclasses" argument """ c = obj.__class__ output = f'<{c.__module__}.{c.__name__} at {hex(id(obj))}>\n' if showclasses: mro = c.mro() if len(mro) > 1: # Remove 'object' unless it's the only class mro = mro[:-1] output += f'{mro}\n' return output
def _get_obj_keys(obj, private=False, sort=True, use_dir=False): """ Helper method to get the keys of an object """ # Get the list of keys if use_dir: # This forces the use of dir(), as opposed to checking for dict or slots keys = obj.__dir__() # This is the unsorted version of dir() else: if hasattr(obj, '__dict__'): keys = obj.__dict__.keys() elif hasattr(obj, '__slots__'): keys = obj.__slots__ else: keys = [] # pragma: no cover if isinstance(private, str): private = [private] # Sort by private keys if not private: keys = [k for k in keys if not k.startswith('__')] elif isinstance(private, list): keys = [k for k in keys if (not k.startswith('__') or k in private)] # Optionally sort if sort: keys = sorted(keys) return list(keys) # Sometimes dict_keys def _is_meth(obj, attr, die=False): """ Helper function to check if an attribute is a method; do not distinguish between bound and unbound | *New in version 3.2.0:* use method and function types instead of callable() """ try: obj = getattr(obj, attr, None) return isinstance(obj, (types.MethodType, types.FunctionType)) # Equivalent to sc.isfunc() except Exception as E: if die: raise E else: return False def _is_prop(obj, attr, die=False): """ Helper function to check if an attribute is a property """ try: obj = getattr(type(obj), attr, None) return isinstance(obj, property) except Exception as E: if die: raise E else: return False
[docs] def objatt(obj, strlen=_strlen, ncol=_ncol, private=False, sort=True, _keys=None, return_keys=False): """ Return a sorted string of object attributes for the Python __repr__ method; see :func:`sc.prepr() <prepr>` for options """ keys = _get_obj_keys(obj, private=private, sort=sort) if _keys is None else _keys if return_keys: return keys else: output = createcollist(keys, 'Attributes', strlen=strlen, ncol=ncol) return output
[docs] def classatt(obj, strlen=_strlen, ncol=_ncol, private=False, sort=True, _objkeys=None, _dirkeys=None, return_keys=False): """ Return a sorted string of class attributes for the Python __repr__ method; see :func:`sc.prepr() <prepr>` for options """ objkeys = _get_obj_keys(obj, private=private, sort=sort, use_dir=False) if _objkeys is None else _objkeys dirkeys = _get_obj_keys(obj, private=private, sort=sort, use_dir=True) if _dirkeys is None else _dirkeys keys = set(dirkeys) - set(objkeys) # Find attributes in dir() that are not in __dict__ keys = list(filter(keys.__contains__, dirkeys)) # Maintain original ordering keys = [k for k in keys if not (_is_meth(obj, k) or _is_prop(obj, k))] if return_keys: return keys else: output = createcollist(keys, 'Class attributes', strlen=strlen, ncol=ncol) return output
[docs] def objmeth(obj, strlen=_strlen, ncol=_ncol, private=False, sort=True, _keys=None, return_keys=False): """ Return a sorted string of object methods for the Python __repr__ method; see :func:`sc.prepr() <prepr>` for options """ try: # In very rare cases this fails, so put it in a try-except loop _keys = _get_obj_keys(obj, private=private, sort=sort, use_dir=True) if _keys is None else _keys _keys = [meth for meth in _keys if _is_meth(obj, meth)] keys = sorted([meth + '()' for meth in _keys]) if return_keys: return _keys except Exception as E: # pragma: no cover keys = [f'Methods N/A ({E})'] output = createcollist(keys, 'Methods', strlen=strlen, ncol=ncol) return output
[docs] def objprop(obj, strlen=_strlen, ncol=_ncol, private=False, sort=True, _keys=None, return_keys=False): """ Return a sorted string of object properties for the Python __repr__ method; see :func:`sc.prepr() <prepr>` for options """ try: # In very rare cases this fails, so put it in a try-except loop _keys = _get_obj_keys(obj, private=private, sort=sort, use_dir=True) if _keys is None else _keys keys = [prop for prop in _keys if _is_prop(obj, prop)] if return_keys: return keys except Exception as E: # pragma: no cover keys = [f'Properties N/A ({E})'] output = createcollist(keys, 'Properties', strlen=strlen, ncol=ncol) return output
[docs] def objrepr(obj, showid=True, showmeth=True, showprop=True, showatt=True, showclassatt=True, private=False, sort=True, dividerchar='—', dividerlen=_dividerlen, strlen=_strlen, ncol=_ncol, _objkeys=None, _dirkeys=None): """ Print out a detailed representation of an object: methods, properties, attributes, etc. Similar to ``sc.prepr(obj, vals=False)``. See :func:`sc.prepr() <prepr>` for an explanation of arguments. """ # Call the object twice to get the keys objkeys = _get_obj_keys(obj, private=private, sort=sort, use_dir=False) if _objkeys is None else _objkeys dirkeys = _get_obj_keys(obj, private=private, sort=sort, use_dir=True) if _dirkeys is None else _dirkeys divider = dividerchar*dividerlen + '\n' output = '' def assemble(show, string): """ Helper function to construct the string """ return string + divider if (show and string) else '' # Assemble the output string output += assemble(showid, objectid(obj, showclasses=True)) output += assemble(showmeth, objmeth(obj, strlen=strlen, ncol=ncol, _keys=dirkeys)) output += assemble(showprop, objprop(obj, strlen=strlen, ncol=ncol, _keys=dirkeys)) output += assemble(showatt, objatt(obj, strlen=strlen, ncol=ncol, _keys=objkeys)) output += assemble(showclassatt, classatt(obj, strlen=strlen, ncol=ncol, _objkeys=objkeys, _dirkeys=dirkeys)) return output
[docs] def prepr(obj, vals=True, maxlen=None, maxitems=None, skip=None, dividerchar='—', dividerlen=_dividerlen, use_repr=True, private=False, sort=True, strlen=_strlen, ncol=_ncol, maxtime=3, maxrecurse=5, die=False, debug=False): """ Pretty-print a detailed representation of an object. This function returns a pretty (and pretty detailed) representation of an object -- all attributes (except any that are skipped), plus methods and ID. This function is usually used via the interactive :func:`sc.pr() <pr>` (which prints), rather than this function (which returns a string). Args: obj (anything): the object to be represented vals (bool): whether to show attribute values (else, just list attributes; similar to :func:`sc.objrepr() <objrepr>`) maxlen (int): maximum number of characters to show for each attribute maxitems (int): maximum number of attribute to show in the object skip (list): any attributes to skip dividerchar (str): divider for methods, attributes, etc. dividerlen (int): number of divider characters use_repr (bool): whether to use repr() or str() to parse the object private (bool): whether to include private methods/attributes (those starting with "__") maxtime (float): maximum amount of time (in seconds) to spend on trying to print the object maxrecurse (int): maximum number of levels to descend in the object (set to 0 to turn off the check) die (bool): whether to raise an exception if an error is encountered debug (bool): print out detail during string construction | *New in version 3.0.0:* "debug" argument | *New in version 3.1.4:* more robust handling of invalid object properties | *New in version 3.1.5:* "vals" argument to turn off printing attribute values | *New in version 3.1.6:* "maxrecurse" argument, and checking for recursion **Examples**:: # Default options df = sc.dataframe(a=[1,2,3], b=[4,5,6]) print(df) # See just the data sc.pr(df) # See all the methods too sc.pr(df, vals=False) # Only see methods, not the values # Demonstrate options obj = sc.prettyobj({k:k for k in [l + str(n) for n in range(10) for l in 'abcde']}) # Big object sc.pr(obj, maxitems=20, sort=False, dividerchar='•', dividerlen=43, private=True) """ # Check recursion before we proceed -- adds about 2-5 ms per call, but prevents infinite recursion if maxrecurse: frames = inspect.stack()[:maxrecurse*10] # Only get the most recent frames matches = sum([frame.function in ('prepr', '__repr__', '__str__') for frame in frames]) if matches > maxrecurse: string = f'[sc.prepr(): not shown, recursion exceeded ({matches}>{maxrecurse})]' # This is unlikely to ever be seen since it's deep within the object return string # Decide how to handle representation function -- repr is dangerous since can lead to recursion repr_fn = repr if use_repr else str T = time.time() # Start the timer time_exceeded = False # Handle input arguments divider = dividerchar*dividerlen + '\n' if maxlen is None: maxlen = 80 if maxitems is None: maxitems = 100 if skip is None: skip = [] else: skip = sc.tolist(skip) # Initialize things to print out labels = [] values = [] # Call the object twice to get the keys objkeys = _get_obj_keys(obj, private=private, sort=sort, use_dir=False) dirkeys = _get_obj_keys(obj, private=private, sort=sort, use_dir=True) # Wrap entire process for getting attribute strings in a try-except in case it fails E1, E2, E3 = None, None, None kw = dict(private=private, sort=sort, dividerchar=dividerchar, dividerlen=dividerlen, strlen=strlen, ncol=ncol) try: if not (hasattr(obj, '__dict__') or hasattr(obj, '__slots__')): # pragma: no cover # It's a plain object labels = [f'{type(obj)}'] values = [repr_fn(obj)] else: labels = objkeys labels += classatt(obj, private=private, sort=sort, return_keys=True, _objkeys=objkeys, _dirkeys=dirkeys) if skip is not None: diff = set(labels) - set(skip) labels = list(filter(diff.__contains__, labels)) if debug: # pragma: no cover print(f'Working on {len(labels)} entries...') if not len(labels): extraitems = 0 else: # Usual case extraitems = max(0, len(labels) - maxitems) if extraitems > 0: labels = labels[:maxitems] # Get the values of the attributes values = [] if vals: for a,attr in enumerate(labels): if debug: # pragma: no cover tdiff = time.time() - T print(f' Working on attribute {a}: {attr}... ({tdiff:0.3f})') if (time.time() - T) < maxtime: try: # Be especially robust in getting individual attributes value = getattr(obj, attr) except Exception as E: value = 'N/A' # pragma: no cover if die: raise E try: # Separately, be robust about getting their attributes value = repr_fn(value) except Exception as E: value = object.__repr__(value) # pragma: no cover if die: raise E values.append(value) else: labels = labels[:a] labels.append('etc. (time exceeded)') values.append(f'{len(labels)-a} entries not shown') time_exceeded = True break if extraitems > 0: labels.append('etc. (too many items)') values.append(f'{extraitems} entries not shown') # Decide how to print them maxkeylen = 0 if len(labels): maxkeylen = max([len(label) for label in labels]) # Find the maximum length of the attribute keys if maxkeylen<maxlen: maxlen = maxlen - maxkeylen # Shorten the amount of data shown if the keys are long formatstr = f'%{maxkeylen}s' # Assemble the format string for the keys, e.g. '%21s' # Actually get the methods output = objrepr(obj, showatt=False, showclassatt=False, _objkeys=objkeys, _dirkeys=dirkeys, **kw) if not len(labels): output += 'No attributes\n' else: if vals: for label,value in zip(labels,values): # Loop over each attribute if len(value)>maxlen: value = value[:maxlen] + ' [...]' # Shorten it prefix = formatstr%label + ': ' # The format key output += indent(prefix, value) else: output += createcollist(labels, 'Attributes', strlen=strlen, ncol=ncol) output += divider if time_exceeded: timestr = f'\nNote: the object did not finish printing within maxtime={maxtime} s.\n' timestr += 'To see the full object, call prepr() with increased maxtime.' output += timestr # If that failed, try progressively simpler approaches except Exception as E: # pragma: no cover E1 = E if die: errormsg = 'Failed to create pretty representation of object' raise RuntimeError(errormsg) from E else: try: # Next try the objrepr, which is the same except doesn't print attribute values output = objrepr(obj, **kw) output += f'\nWarning: showing simplified output since full repr failed {str(E)}' except Exception as E: # If that fails, try the most basic object representation E2 = E output = object.__repr__(obj) if any([E is not None for E in [E1, E2, E3]]): warnmsg = f'Exception(s) encountered displaying object {objectid(obj)}:\n' if E1 is not None: warnmsg += f'{E1}\n' if E2 is not None: warnmsg += f'{E2}\n' if E3 is not None: warnmsg += f'{E3}\n' warnings.warn(warnmsg, category=RuntimeWarning, stacklevel=2) return output
[docs] def pr(obj, *args, **kwargs): """ Pretty-print a detailed representation of an object ("pr" is short for "print repr"). See :func:`sc.prepr() <prepr>` for arguments and examples. Note: :func:`sc.prepr() <prepr>` creates a string, while ``sc.pr()`` prints the output, i.e. ``sc.pr(obj)`` is an alias to ``print(sc.prepr(obj))``. """ print(prepr(obj, *args, **kwargs)) return
[docs] class prettyobj: """ Use pretty repr for objects, instead of just showing the type and memory pointer (the Python default for objects). Can also be used as the base class for custom classes. See :class:`sc.quickobj() <quickobj>` for a similar class that does not print attribute values (better for large objects that take a while to display). Args: args (dict): dictionaries which are used to assign attributes kwargs (any): can also be used to assign attributes **Example 1**:: myobj = sc.prettyobj(a=3) print(myobj) # <sciris.sc_printing.prettyobj at 0x7fbba4a97f40> # ———————————————————————————————————————————————————————————— # Methods: # Methods N/A # ———————————————————————————————————————————————————————————— # a: 3 # ———————————————————————————————————————————————————————————— **Example 2**:: myobj = sc.prettyobj(a=3) myobj.b = {'a':6} print(myobj) # <sciris.sc_printing.prettyobj at 0x7ffa1e243910> # ———————————————————————————————————————————————————————————— # Methods: # Methods N/A # ———————————————————————————————————————————————————————————— # a: 3 # b: {'a': 6} # ———————————————————————————————————————————————————————————— **Example 3**:: class MyObj(sc.prettyobj): def __init__(self, a, b): self.a = a self.b = b def mult(self): return self.a * self.b myobj = MyObj(a=4, b=6) print(myobj) # <__main__.MyObj at 0x7fd9acd96c10> # ———————————————————————————————————————————————————————————— # Methods: # mult() # ———————————————————————————————————————————————————————————— # a: 4 # b: 6 # ———————————————————————————————————————————————————————————— | *New in version 2.0.0:* allow positional arguments | *New in version 3.1.4:* moved from sc_utils to sc_printing | *New in version 3.1.6:* linked back to sc_utils to prevent unpickling errors """ def __init__(self, *args, **kwargs): """ Simple initialization """ kwargs = sc.mergedicts(*args, kwargs) for k,v in kwargs.items(): self.__dict__[k] = v return def __repr__(self): """ The point of this class: use a more detailed repr by default """ return prepr(self)
# Handle deprecation so loading old pickles still works scu.prettyobj = prettyobj
[docs] class quickobj(prettyobj): """ Like :class:`sc.prettyobj() <prettyobj>`, but do not print attribute values. This class is better for large objects that take a while to display. It is somewhat similar to calling dir() on an object. This class also defines a ``disp()`` method, which calls :func:`sc.pr() <pr>` on the object. **Example**:: import numpy as np myobj = sc.quickobj(big1=np.random.rand(100,100), big2=sc.dataframe(a=np.arange(1000))) print(myobj) | *New in version 3.1.5.* """ def __repr__(self): """ Use a more detailed repr than default, but less detailed that prettyobj """ return prepr(self, vals=False)
[docs] def disp(self, output=False, *args, **kwargs): """ Return full display of the object """ string = prepr(self, *args, **kwargs) if output: return string else: print(string) return
#%% Spacing functions __all__ += ['blank', 'indent']
[docs] def blank(n=3): """ Tiny function to print n blank lines, 3 by default """ print('\n'*n)
[docs] def indent(prefix=None, text=None, suffix='\n', n=0, pretty=False, width=70, **kwargs): """ Small wrapper to make textwrap more user friendly. Args: prefix (str): text to begin with (optional) text (str): text to wrap suffix (str): what to put on the end (by default, a newline) n (int): if prefix is not specified, the size of the indent pretty (bool): whether to use pprint to format the text width (int): maximum width before wrapping (if None, don't wrap) kwargs (dict): passed to :func:`textwrap.fill()` **Examples**:: prefix = 'and then they said: ' text = 'blah '*100 print(sc.indent(prefix, text)) print('my fave is: ' + sc.indent(text=rand(100), n=12)) *New in version 1.3.1:* more flexibility in arguments """ # If "prefix" is given but text isn't, swap them if text is None and prefix is not None: # pragma: no cover text, prefix = prefix, text # Handle prefix and width if prefix is None: prefix = ' '*n if width is None: width = 999_999 # Get text in the right format -- i.e. a string if pretty: text = pprint.pformat(text) else: text = sc.flexstr(text) # If there is no newline in the text, process the output normally. if text.find('\n') == -1: output = fill(text, initial_indent=prefix, subsequent_indent=' '*len(prefix), width=width, **kwargs)+suffix # Otherwise, handle each line separately and splice together the output. else: textlines = text.split('\n') output = '' for i, textline in enumerate(textlines): if i == 0: theprefix = prefix else: theprefix = ' '*len(prefix) output += fill(textline, initial_indent=theprefix, subsequent_indent=' '*len(prefix), width=width, **kwargs)+suffix if n: output = output[n:] # Need to remove the fake prefix return output
#%% Data representation functions __all__ += ['sigfig', 'sigfigs', 'sigfiground', 'arraymean', 'arraymedian', 'printmean', 'printmedian', 'humanize_bytes', 'printarr', 'printdata', 'printvars']
[docs] def sigfig(x, sigfigs=4, SI=False, sep=False, keepints=False, formats=None): """ Return a string representation of variable x with sigfigs number of significant figures Note: :func:`sc.sigfig() <sigfig>` and :func:`sc.sigfigs() <sigfigs>` are aliases. Args: x (int/float/list/arr): the number(s) to round sigfigs (int): number of significant figures to round to (if None, use 'g' format) SI (bool): whether to use SI notation (only for numbers >1) sep (bool/str): if provided, use as thousands separator keepints (bool): never round ints formats (str/list): custom format suffixes; if str (e.g. 'kmb'), split into chars; if list (e.g. ['k','m','bn']), use as-is for 1e3, 1e6, etc. **Examples**:: x = 3432.3842 sc.sigfig(x, SI=True) # Returns '3.432K' sc.sigfig(x, sep=True) # Returns '3,432' sc.sigfig(x, SI=True, formats='kmb') # Returns '3.432k' (lowercase) sc.sigfig(x, sigfigs=None) # Returns '3432.38' (uses 'g' format) vals = np.random.rand(5) sc.sigfig(vals, sigfigs=3) | *New in version 3.0.0:* changed default number of significant figures from 5 to 4; return list rather than tuple; changed SI suffixes to uppercase | *New in version 3.2.6:* "formats" argument; use 'g' format when sigfigs=None """ output = [] islist = sc.isiterable(x) istuple = isinstance(x, tuple) xlist = x if islist else sc.tolist(x) for x in xlist: suffix = '' # Handle custom formats if formats is None: format_map = [(1e18,'e18'), (1e15,'e15'), (1e12,'T'), (1e9,'B'), (1e6,'M'), (1e3,'K')] else: formats_list = sc.tolist(formats) # Map formats to magnitudes (thousand, million, billion, trillion, etc.) magnitudes = [1e3, 1e6, 1e9, 1e12, 1e15, 1e18] format_map = [] for i, fmt in enumerate(formats_list): if i < len(magnitudes): format_map.append((magnitudes[i], fmt)) format_map.reverse() # Process from largest to smallest if SI: for val,suff in format_map: if abs(x) >= val: x = x/val suffix = suff break # Find at most one match try: if x == 0: output.append('0') elif sigfigs is None: output.append(f'{x:g}'+suffix) elif x > (10**sigfigs) and not SI and keepints: # e.g. x = 23432.23, sigfigs=3, output is 23432 roundnumber = int(round(x)) if sep: string = format(roundnumber, ',') else: string = f'{x:0.0f}' output.append(string) else: magnitude = np.floor(np.log10(abs(x))) factor = 10**(sigfigs-magnitude-1) x = round(x*factor)/float(factor) digits = int(abs(magnitude) + max(0, sigfigs - max(0,magnitude) - 1) + 1 + (x<0) + (abs(x)<1)) # one because, one for decimal, one for minus decimals = int(max(0,-magnitude+sigfigs-1)) strformat = '%' + f'{digits}.{decimals}' + 'f' string = strformat % x if sep: # To insert separators in the right place, have to convert back to a number if decimals>0: roundnumber = float(string) else: roundnumber = int(string) string = format(roundnumber, ',') # Allow comma separator string += suffix output.append(string) except: # pragma: no cover output.append(sc.flexstr(x)) if islist: if istuple: output = tuple(output) return output else: return output[0]
# Alias to avoid confusion sigfigs = sigfig
[docs] def sigfiground(x, sigfigs=4): """ Round number(s) to the specified number of significant figures. Args: x (int/float/list/arr): the number(s) to round sigfigs (int): number of significant figures to round to **Examples**:: sc.sigfiground(3.28343) # Returns 3.283 sc.sigfiground(834_875, 5) # Returns 834880 sc.sigfiground([3.28343, 834_874, 0, -83_742], 2) # Returns [3.3, 830000, 0, -84000] | *New in version 3.2.0.* """ def round_arr(arr, sigfigs): """ Function for rounding a single number """ out = arr.copy() # Preallocate output inds = np.nonzero(arr) # Skip zero indices nzarr = arr[inds] # Pull out those values magnitude = np.floor(np.log10(np.abs(nzarr))) # Determine the order of magnitude of the number exponent = sigfigs - magnitude - 1 # Convert to an exponent factor = 10**exponent # Calculate the factor to scale the number rndarr = np.round(nzarr*factor)/factor # Round the scaled number and scale it back out[inds] = rndarr # Put the rounded numbers back in the array if np.all(exponent <= 0): # They're all integers out = out.astype(np.int64) return out # Process inputs arr = sc.toarray(x) out = round_arr(arr, sigfigs) # Do the rounding if sc.isnumber(x): out = out[0] elif isinstance(x, list): out = out.tolist() out = [int(x) if x.is_integer() else x for x in out] # Allow mix of ints and floats return out
[docs] def arraymean(data, stds=2, axis=None, mean_sf=None, err_sf=None, tostring=True, doprint=False, **kwargs): """ Quickly calculate the mean and standard deviation of an array. By default, will calculate the correct number of significant figures based on the deviation. The default is to multiply the standard deviation by 2, as an approximation of the 95% confidence level (z=1.96). Args: data (array): the data to summarize stds (int): the number of multiples of the standard deviation to show (default 2) axis (int): the axis of the data to operate on (default None) mean_sf (int): if provided, use this number of significant figures for the mean rather than the auto-calculated err_sf (int): ditto, but for the error (standard deviation) doprint (bool): whether to print (else, return the string) kwargs (dict): passed to :func:`sc.sigfig() <sigfig>` **Example**:: data = [1210, 1072, 1722, 1229, 1902] sc.arraymean(data) # Returns 1430 ± 320 | *New in version 3.0.0.* | *New in version 3.2.0:* "axis" argument, "tostring" argument (allow numerical output) """ vsf = mean_sf # vsf = "value significant figures" esf = err_sf if err_sf is not None else 2 data = sc.toarray(data) val = data.mean(axis=axis) err = data.std(axis=axis)*stds relsize = np.floor(np.log10(abs(val))) - np.floor(np.log10(abs(err))) if vsf is None: vsf = esf + relsize elif vsf is not None and err_sf is None: esf = min(vsf, vsf - relsize) if tostring: valstr = sigfig(val, vsf, **kwargs) errstr = sigfig(err, esf, **kwargs) string = f'{valstr} ± {errstr}' if doprint: print(string) else: return string else: valnum = sigfiground(val, vsf) errnum = sigfiground(err, esf) return valnum, errnum
[docs] def arraymedian(data, ci=95, sf=3, doprint=False, **kwargs): """ Quickly calculate the median and confidence interval of an array. The confidence interval defaults to 95%. If an integer is supplied, this is treated as a percentile (e.g. 95=95% CI). If a float is supplied, it's treated as a quantile (e.g. 0.95=95% CI). If a pair of ints or floats is provided, these are treated as upper and lower percentiles/quantiles. If 'iqr' is provided, then print the interquartile range (equivalent to 50% CI). If 'range' is provided then print the full range (equivalent to 100% CI). Args: data (array): the data to summarize ci (int/float/list/str): the confidence interval to use to use (see above for details) sf (int): number of significant figures to use doprint (bool): whether to print (else, return the string) kwargs (dict): passed to :func:`sc.sigfig() <sigfig>` **Examples**:: data = [1210, 1072, 1722, 1229, 1902] sc.printmedian(data, 80) # Returns '1230 (80.0% CI: 1130, 1830)' *New in version 3.0.0.* """ # Handle quantiles if ci is None: # pragma: no cover ci = 95 elif str(ci).lower() == 'iqr': ci = 50 elif str(ci).lower() in ['range', 'minmax']: ci = 100 if sc.isnumber(ci): if isinstance(ci, int): x = ci/100/2 elif isinstance(ci, float): x = ci/2 quantiles = [0.5-x, 0.5+x] if x == 0.25: cistr = 'IQR' elif x == 0.5: cistr = 'min, max' else: cistr = f'{x*100*2:n}% CI' elif sc.isiterable(ci): if len(ci) != 2: # pragma: no cover errormsg = f'If providing a list of quantiles, must provide 2, not {len(ci)}' raise ValueError(errormsg) quantiles = ci for i,q in enumerate(quantiles): if isinstance(q, int): quantiles[i] = q/100 cistr = f'{quantiles[0]*100:n}%, {quantiles[1]*100:n}%' else: # pragma: no cover errormsg = f'Could not understand confidence interval "{ci}"' raise ValueError(errormsg) # Do calculations data = sc.toarray(data) median = np.quantile(data, 0.5) bounds = np.quantile(data, quantiles) relsize = np.floor(np.log10(abs(median))) - np.floor(np.log10(np.abs(bounds))) # Assemble string valstr = sigfig(median, sf, **kwargs) lowstr = sigfig(bounds[0], sf-relsize[0], **kwargs) highstr = sigfig(bounds[1], sf-relsize[1], **kwargs) string = f'{valstr} ({cistr}: {lowstr}, {highstr})' if doprint: print(string) else: return string
[docs] def printmean(*args, doprint=True, **kwargs): """ Alias to :func:`sc.arraymean() <arraymean>` with doprint=True """ return arraymean(*args, doprint=doprint, **kwargs)
[docs] def printmedian(*args, doprint=True, **kwargs): """ Alias to :func:`sc.arraymedian() <arraymedian>` with doprint=True """ return arraymedian(*args, doprint=doprint, **kwargs)
[docs] def humanize_bytes(bytesize, decimals=3): """ Convert a number of bytes into a human-readable total. Args: bytesize (int): the number of bytes decimals (int): the number of decimal places to show **Example**:: sc.humansize(2.3423887e6, decimals=2) # Returns '2.34 MB' See the humansize library for more flexibility. *New in version 3.0.0.* """ # Convert to string factor = 1 label = 'B' labels = ['KB','MB','GB'] for i,f in enumerate([3,6,9]): if bytesize >= 10**f: factor = 10**f label = labels[i] if factor == 1: decimals = 0 # Do not show decimals for bytes humansize = float(bytesize/float(factor)) string = f'{humansize:0.{decimals}f} {label}' return string
[docs] def printarr(arr, fmt=None, colsep=' ', vsep='—', decimals=2, doprint=True, dtype=None): """ Print a numpy array nicely. Args: arr (array): the array to print fmt (str): the formatting string to use colsep (str): the separator between columns of values vsep (str): the vertical separator between 2D slices decimals (int): number of decimal places to print doprint (bool): whether to print (else, return the string) **Examples**:: numeric = np.random.randn(3,7,4)**10 mixed = np.array([['cat', 'nudibranch'], [23, 2423482]], dtype=object) sc.printarr(numeric) sc.printarr(mixed) *New in version 2.0.3:* "fmt", "colsep", "vsep", "decimals", and "dtype" arguments *New in version 3.0.0:* "doprint" argument """ from . import sc_math as scm # To avoid circular import string = '' arr = sc.toarray(arr, dtype=dtype) if fmt is None: # Check for object or string dtypes (pandas 3.0.0 infers strings as 'str' instead of 'object') if arr.dtype == object or arr.dtype.kind in ['U', 'S', 'O']: # pragma: no cover maxdigits = max([len(str(v)) for v in arr.flatten()]) fmt = f'%{maxdigits}s' else: maxdigits = sc.numdigits(arr.max()) if arr.dtype == float: fmt = f'%{maxdigits+decimals+1}.{decimals}f' else: # pragma: no cover fmt = f'%{maxdigits}.0f' if np.ndim(arr)==1: for i in range(len(arr)): string += fmt % arr[i] + colsep string += '\n' elif np.ndim(arr)==2: for i in range(len(arr)): string += printarr(arr[i], fmt, colsep, doprint=False) + '\n' elif np.ndim(arr)==3: for i in range(len(arr)): ncols = len(arr[i][0]) vlen = len(fmt % arr.flatten()[0]) seplen = len(colsep) n = ncols*(vlen + seplen) - seplen string += vsep*n + '\n' for j in range(len(arr[i])): string += printarr(arr[i][j], fmt, colsep, doprint=False) else: # pragma: no cover print('Dimensions higher than 3 are not supported') string = str(arr) # Give up if doprint: print(string) else: return string
[docs] def printdata(data, name='Variable', depth=1, maxlen=40, indent='', level=0, showcontents=False): # pragma: no cover """ Nicely print a complicated data structure, a la Matlab. Note: this function is deprecated. Args: data: the data to display name: the name of the variable (automatically read except for first one) depth: how many levels of recursion to follow maxlen: number of characters of data to display (if 0, don't show data) indent: where to start the indent (used internally) Version: 2015aug21 """ datatype = type(data) def printentry(data): if datatype==dict: string = (f'dict with {len(data.keys())} keys') elif datatype==list: string = (f'list of length {len(data)}') elif datatype==tuple: string = (f'tuple of length {len(data)}') elif datatype==np.ndarray: string = (f'array of shape {np.shape(data)}') elif datatype.__name__=='module': string = (f'module with {len(dir(data))} components') elif datatype.__name__=='class': string = (f'class with {len(dir(data))} components') else: string = datatype.__name__ if showcontents and maxlen>0: datastring = ' | '+sc.flexstr(data) if len(datastring)>maxlen: datastring = datastring[:maxlen] + ' <etc> ' + datastring[-maxlen:] else: datastring='' return string+datastring string = printentry(data).replace('\n',' ') # Remove newlines print(level*'..' + indent + name + ' | ' + string) if depth>0: level += 1 if type(data)==dict: keys = data.keys() maxkeylen = max([len(key) for key in keys]) for key in keys: thisindent = ' '*(maxkeylen-len(key)) printdata(data[key], name=key, depth=depth-1, indent=indent+thisindent, level=level) elif type(data) in [list, tuple]: for i in range(len(data)): printdata(data[i], name='[%i]'%i, depth=depth-1, indent=indent, level=level) elif type(data).__name__ in ['module', 'class']: keys = dir(data) maxkeylen = max([len(key) for key in keys]) for key in keys: if key[0]!='_': # Skip these thisindent = ' '*(maxkeylen-len(key)) printdata(getattr(data,key), name=key, depth=depth-1, indent=indent+thisindent, level=level) print('\n') return
[docs] def printvars(localvars=None, varlist=None, label=None, divider=True, spaces=1, color=None): """ Print out a list of variables. Note that the first argument must be locals(). Args: localvars: function must be called with locals() as first argument varlist: the list of variables to print out label: optional label to print out, so you know where the variables came from divider: whether or not to offset the printout with a spacer (i.e. ------) spaces: how many spaces to use between variables color: optionally label the variable names in color so they're easier to see **Example**:: >>> a = range(5) >>> b = 'example' >>> sc.printvars(locals(), ['a','b'], color='green') Another useful usage case is to print out the kwargs for a function: >>> sc.printvars(locals(), kwargs.keys()) Version: 2017oct28 """ varlist = sc.tolist(varlist) # Make sure it's actually a list dividerstr = '-'*40 if label: print(f'Variables for {label}:') if divider: print(dividerstr) for varnum,varname in enumerate(varlist): controlstr = f'{varnum}. "{varname}": ' # Basis for the control string -- variable number and name if color: controlstr = colorize(color, output=True) + controlstr + colorize('reset', output=True) # Optionally add color if spaces>1: controlstr += '\n' # Add a newline if the variables are going to be on different lines try: controlstr += f'{localvars[varname]}' # The variable to be printed except: controlstr += 'Warning, could not be printed' # In case something goes wrong # pragma: no cover controlstr += '\n' * spaces # The number of spaces to add between variables print(controlstr), # Print it out if divider: print(dividerstr) # If necessary, print the divider again return
#%% Color functions __all__ += ['colorize', 'heading', 'printred', 'printyellow', 'printgreen', 'printcyan', 'printblue', 'printmagenta']
[docs] def colorize(color=None, string=None, doprint=None, output=False, enable=True, showhelp=False, fg=None, bg=None, style=None): """ Colorize output text. Args: color (str): the color you want (use 'bg' with background colors, e.g. 'bgblue'); alternatively, use fg, bg, and style string (str): the text to be colored doprint (bool): whether to print the string (default true unless output) output (bool): whether to return the modified version of the string (default false) enable (bool): switch to allow :func:`sc.colorize() <colorize>` to be easily turned off without converting to a :func:`print()` statement showhelp (bool): show help rather than changing colors fg (str): foreground colour bg (str): background colour style (str): font style (eg, italic, underline, bold) **Examples**:: sc.colorize('green', 'hi') # Simple example sc.colorize(['yellow', 'bgblack']); print('Hello world'); print('Goodbye world'); colorize() # Colorize all output in between bluearray = sc.colorize(color='blue', string=str(range(5)), output=True); print("c'est bleu: " + bluearray) sc.colorize('magenta') # Now type in magenta for a while sc.colorize() # Stop typing in magenta sc.colorize('cat in the hat', fg='#ffa044', bg='blue', style='italic+underline') # Alternate usage example To get available colors, type :func:`sc.colorize(showhelp=True) <colorize>`. | *New in version 1.3.1:* "doprint" argument; ansicolors shortcut """ # Handle short-circuit case if not enable: # pragma: no cover if output: return string else: print(string) return # Decide which path we'll be taking ansistring = '' alt_usage = (fg is not None) or (bg is not None) or (style is not None) # Handle alternate usage pattern -- string as first argument rather than color, so swap if alt_usage: if string is None and color is not None: string, color = color, string if color is not None: # pragma: no cover errormsg = 'You can supply either color or fg, but not both' raise ValueError(errormsg) if ansi_support: ansistring = ansi.color(s=string, fg=fg, bg=bg, style=style) # Actually apply color else: ansistring = str(string) # Otherwise, just return the string # pragma: no cover # Original use case else: # Define ANSI colors ansicolors = co.OrderedDict([ ('black', '30'), ('red', '31'), ('green', '32'), ('yellow', '33'), ('blue', '34'), ('magenta', '35'), ('cyan', '36'), ('gray', '37'), ('bgblack', '40'), ('bgred', '41'), ('bggreen', '42'), ('bgyellow', '43'), ('bgblue', '44'), ('bgmagenta', '45'), ('bgcyan', '46'), ('bggray', '47'), ('reset', '0'), ]) for key, val in ansicolors.items(): ansicolors[key] = '\033[' + val + 'm' # Determine what color to use colorlist = sc.tolist(color) # Make sure it's a list for color in colorlist: if color not in ansicolors.keys(): # pragma: no cover print(f'Color "{color}" is not available, use colorize(showhelp=True) to show options.') return # Don't proceed if the color isn't found ansicolor = '' for color in colorlist: ansicolor += ansicolors[color] # Modify string, if supplied if string is None: ansistring = ansicolor # Just return the color else: ansistring = ansicolor + str(string) + ansicolors['reset'] # Add to start and end of the string if not ansi_support: # pragma: no cover ansistring = str(string) # To avoid garbling output on unsupported systems if showhelp: print('Available colors are:') for key in ansicolors.keys(): if key[:2] == 'bg': darks = ['bgblack', 'bgred', 'bgblue', 'bgmagenta'] if key in darks: foreground = 'gray' else: foreground = 'black' helpcolor = [foreground, key] else: helpcolor = key colorize(helpcolor, ' ' + key) return sc.sc_utils._printout(string=ansistring, doprint=doprint, output=output)
# Alias certain colors functions -- not including white and black since poor practice on light/dark terminals
[docs] def printred(s, **kwargs): """ Alias to print(colors.red(s)) """ return print(ansi.red(s, **kwargs))
[docs] def printgreen(s, **kwargs): """ Alias to print(colors.green(s)) """ return print(ansi.green(s, **kwargs))
[docs] def printblue(s, **kwargs): """ Alias to print(colors.blue(s)) """ return print(ansi.blue(s, **kwargs))
[docs] def printcyan(s, **kwargs): """ Alias to print(colors.cyan(s)) """ return print(ansi.cyan(s, **kwargs))
[docs] def printyellow(s, **kwargs): """ Alias to print(colors.yellow(s)) """ return print(ansi.yellow(s, **kwargs))
[docs] def printmagenta(s, **kwargs): """ Alias to print(colors.magenta(s)) """ return print(ansi.magenta(s, **kwargs))
[docs] def heading(string='', *args, color='cyan', divider='—', spaces=2, spacesafter=1, minlength=10, maxlength=200, sep=' ', doprint=None, output=False, **kwargs): """ Create a colorful heading. If just supplied with a string (or list of inputs like print()), create blue text with horizontal lines above and below and 3 spaces above. You can customize the color, the divider character, how many spaces appear before the heading, and the minimum length of the divider (otherwise will expand to match the length of the string, up to a maximum length). Args: string (str): the string to print as the heading (or object to convert to a string) args (list): additional strings to print color (str): color to use for the heading (default cyan) divider (str): symbol to use for the divider (default '—') spaces (int): number of spaces to put before the heading (default 2) spacesafter (int): number of spaces to put after the heading (default 1) minlength (int): minimum length of the divider (default 10) maxlength (int): maximum length of the divider (default 200) sep (str): if multiple arguments are supplied, use this separator to join them doprint (bool): whether to print the string (default true if no output) output (bool): whether to return the string as output (else, print) kwargs (dict): passed to :func:`sc.colorize() <colorize>` Returns: Formatted string if ``output=True`` **Examples**:: sc.heading('This is a heading') sc.heading(string='This is also a heading', color='red', divider='*', spaces=0, minlength=50) | *New in version 1.3.1.*: "spacesafter" """ # Convert to single string args = sc.mergelists(string, list(args)) string = sep.join([str(item) for item in args]) # Add header and footer length = int(np.median([minlength, len(string), maxlength])) space = '\n'*spaces spaceafter = '\n'*spacesafter fulldivider = divider*length if fulldivider: string = sc.newlinejoin(fulldivider, string, fulldivider) fullstring = space + string + spaceafter # Create output return colorize(color=color, string=fullstring, doprint=doprint, output=output, **kwargs)
#%% Other __all__ += ['printv', 'slacknotification', 'printtologfile', 'percentcomplete', 'progressbar', 'progressbars', 'capture']
[docs] def printv(string, thisverbose=1, verbose=2, indent=2, **kwargs): """ Optionally print a message and automatically indent. The idea is that a global or shared "verbose" variable is defined, which is passed to subfunctions, determining how much detail to print out. The general idea is that verbose is an integer from 0-4 as follows: * 0 = no printout whatsoever * 1 = only essential warnings, e.g. suppressed exceptions * 2 = standard printout * 3 = extra debugging detail (e.g., printout on each iteration) * 4 = everything possible (e.g., printout on each timestep) Thus a very important statement might be e.g. >>> sc.printv('WARNING, everything is wrong', 1, verbose) whereas a much less important message might be >>> sc.printv(f'This is timestep {i}', 4, verbose) Args: string (str): string to print thisverbose (int): level of verbosity at which to print this message verbose (int): global verbose variable indent (int): amount by which to indent based on verbosity level kwargs (dict): passed to :func:`print()` *New in version 3.0.0:* "kwargs" argument; removed "newline" argument """ if verbose >= thisverbose: # Only print if sufficiently verbose indents = ' '*thisverbose*indent # Create automatic indenting print(indents+sc.flexstr(string), **kwargs) # Actually print return
[docs] def slacknotification(message=None, webhook=None, to=None, fromuser=None, verbose=2, die=False): # pragma: no cover """ Send a Slack notification when something is finished. The webhook is either a string containing the webhook itself, or a plain text file containing a single line which is the Slack webhook. By default it will look for the file ".slackurl" in the user's home folder. The webhook needs to look something like "https://hooks.slack.com/services/af7d8w7f/sfd7df9sb/lkcpfj6kf93ds3gj". Webhooks are effectively passwords and must be kept secure! Alternatively, you can specify the webhook in the environment variable SLACKURL. Args: message (str): The message to be posted. webhook (str): See above to (str): The Slack channel or user to post to. Channels begin with #, while users begin with @ (note: ignored by new-style webhooks) fromuser (str): The pseudo-user the message will appear from (note: ignored by new-style webhooks) verbose (bool): How much detail to display. die (bool): If false, prints warnings. If true, raises exceptions. **Example**:: sc.slacknotification('Long process is finished') sc.slacknotification(webhook='/.slackurl', channel='@username', message='Hi, how are you going?') What's the point? Add this to the end of a very long-running script to notify your loved ones that the script has finished. Version: 2018sep25 """ try: from requests import post # Simple way of posting data to a URL from json import dumps # For sanitizing the message except Exception as E: errormsg = f'Cannot use Slack notification since imports failed: {str(E)}' if die: raise ImportError(errormsg) else: print(errormsg) # Validate input arguments printv('Sending Slack message', 1, verbose) if not webhook: webhook = os.path.expanduser('~/.slackurl') if not to: to = '#general' if not fromuser: fromuser = 'sciris-bot' if not message: message = 'This is an automated notification: your notifier is notifying you.' printv(f'Channel: {to} | User: {fromuser} | Message: {message}', 3, verbose) # Print details of what's being sent # Try opening webhook as a file if webhook.find('hooks.slack.com')>=0: # It seems to be a URL, let's proceed slackurl = webhook elif os.path.exists(os.path.expanduser(webhook)): # If not, look for it as a file with open(os.path.expanduser(webhook)) as f: slackurl = f.read() elif os.getenv('SLACKURL'): # See if it's set in the user's environment variables slackurl = os.getenv('SLACKURL') else: slackurl = webhook # It doesn't seemt to be a URL but let's try anyway errormsg = f'"{webhook}" does not seem to be a valid webhook string or file' if die: raise ValueError(errormsg) else: print(errormsg) # Package and post payload try: payload = '{"text": %s, "channel": %s, "username": %s}' % (dumps(message), dumps(to), dumps(fromuser)) printv(f'Full payload: {payload}', 4, verbose) response = post(url=slackurl, data=payload) printv(response, 3, verbose) # Optionally print response printv('Message sent.', 2, verbose) # We're done except Exception as E: errormsg = f'Sending of Slack message failed: {repr(E)}' if die: raise RuntimeError(errormsg) else: print(errormsg) return
[docs] def printtologfile(message=None, filename=None): """ Append a message string to a file specified by a filename name/path. Note: in almost all cases, you are better off using Python's built-in logging system rather than this function. """ # Set defaults if message is None: # pragma: no cover return # Return immediately if nothing to append if filename is None: import tempfile tempdir = tempfile.gettempdir() filename = os.path.join(tempdir, 'logfile') # Some generic filename that should work on *nix systems # Try writing to file try: with open(filename, 'a') as f: f.write('\n'+message+'\n') # Add a newline to the message. except Exception as E: # pragma: no cover # Fail gracefully print(f'Warning, could not write to logfile {filename}: {str(E)}') return
[docs] def percentcomplete(step=None, maxsteps=None, stepsize=1, prefix=None): """ Display progress as a percentage. **Examples**:: maxiters = 500 # Will print on every 5th iteration for i in range(maxiters): sc.percentcomplete(i, maxiters) # Will print on every 50th iteration for i in range(maxiters): sc.percentcomplete(i, maxiters, stepsize=10) # Will print e.g. 'Completeness: 1%' for i in range(maxiters): sc.percentcomplete(i, maxiters, prefix='Completeness: ') See also :func:`sc.progressbar() <progressbar>` for a progress bar. """ if prefix is None: prefix = ' ' elif sc.isnumber(prefix): # pragma: no cover prefix = ' '*prefix onepercent = max(stepsize,round(maxsteps/100*stepsize)) # Calculate how big a single step is -- not smaller than 1 if not step%onepercent: # Does this value lie on a percent thispercent = round(step/maxsteps*100) # Calculate what percent it is print(prefix + '%i%%'% thispercent) # Display the output return
[docs] def progressbar(i=None, maxiters=None, label='', every=1, length=30, empty='—', full='•', newline=False, flush=False, **kwargs): """ Show a progress bar for a for loop. It can be called manually inside each iteration of the loop, or it can be used to wrap the object being iterated. In the latter case, it acts as an alias for the ``tqdm.tqdm()`` progress bar. Args: i (int/iterable): current iteration (for text output), or iterable object (for tqdm) maxiters (int): maximum number of iterations (can also use an object with length) label (str): initial label to print every (int/float): if int, print every "every"th iteration (if 1, print all); if float and <1, print every maxiters*every iteration length (int): length of progress bar empty (str): character for not-yet-completed steps full (str): character for completed steps newline (bool): whether to print each iteration on a new line flush (bool): whether to force-flush the buffer kwargs (dict): passed to ``tqdm.tqdm()``; see its documentation for full options **Examples**:: # Direct usage inside a loop for i in range(20): sc.progressbar(i+1, 20) sc.timedsleep(0.05) # Direct usage inside a loop with custom formatting for i in range(1000): sc.progressbar(i+1, 1000, every=100, length=10, empty=' ', full='✓', newline=True) sc.timedsleep(0.001) # Used to wrap an iterable, using tqdm x = np.arange(100) for i in sc.progressbar(x): plt.pause(0.01) Adapted from example by Greenstick (https://stackoverflow.com/questions/3173320/text-progress-bar-in-the-console) | *New in version 1.3.3:* "every" argument | *New in version 3.0.0:* wrapper for tqdm """ if i is None or sc.isiterable(i): desc = kwargs.pop('desc', label) return tqdm.tqdm(i, desc=desc, **kwargs) # Handle inputs if hasattr(maxiters, '__len__'): maxiters = len(maxiters) ending = None if newline else '\r' if every < 1: # pragma: no cover every = max(1, int(every*maxiters)) # Don't let it go below 1 # Calculate percent and handle zero case if maxiters > 0: pct = i/maxiters*100 else: # pragma: no cover i = 1 maxiters = 1 pct = 100 percent = f'{pct:0.0f}%' # Assemble string filled = int(length*i//maxiters) bar = full*filled + empty*(length-filled) # Print lastiter = (i == maxiters) if not(i%every) or lastiter: print(f'\r{label} {bar} {percent}', end=ending, flush=flush) if lastiter: print() # Newline at the end return
class tqdm_pickle(tqdm.tqdm): """ Simple subclass of tqdm that allows pickling Usually not used directly by the user; used via :func:`sc.progressbars() <progressbars>` instead. Pickling is required for passing ``tqdm`` instances between processes. Based on ``tqdm`` 4.65.0; may become deprecated in future ``tqdm`` releases. *New in version 3.0.0.* """ def __getstate__(self): """ Overwrite default __getstate__ """ d = {k:v for k,v in self.__dict__.items() if k not in ['sp', 'fp']} return d def __setstate__(self, d): # pragma: no cover """ Overwrite default __getstate__ """ self.__dict__ = d self.__dict__['fp'] = tqdm.utils.DisableOnWriteError(sys.stderr, tqdm_instance=self) self.__dict__['sp'] = self.status_printer(self.fp) return
[docs] class progressbars(prettyobj): """ Create multiple progress bars Useful for tracking the progress of multiple long-running tasks. Unlike regular ``tqdm`` instances, this uses a pickable version so it can be used directly in multiprocessing instances. Args: n (int): number of progress bars to create total (float): length of the progress bars label (str/list): an optional prefix for the progress bar, or list of all labels leave (bool): whether to remove the progress bars when they're done kwargs (dict): passed to ``tqdm.tqdm()`` **Note**: bars are supposed to update in-place, but may appear on separate lines instead if not run in the terminal (e.g. if run in IPython environments like Spyder or Jupyter). **Example**:: import sciris as sc import random def run_sim(index, ndays, pbs): for i in range(ndays): val = random.random() sc.timedsleep(val*5/ndays) pbs.update(index) # Update this progress bar based on the index return nsims = 5 ndays = 365 # Create progress bars pbs = sc.progressbars(nsims, total=ndays, label='Sim') # Run tasks sc.parallelize(run_sim, iterarg=range(nsims), ndays=ndays, pbs=pbs) # Produces output like: # Sim 0: 39%|███████████████████████████▊ | 143/365 [00:01<00:01, 137.17it/s] # Sim 1: 42%|████████████████████████████▉ | 154/365 [00:01<00:01, 148.70it/s] # Sim 2: 45%|████████████████████████████████ | 165/365 [00:01<00:01, 144.19it/s] # Sim 3: 44%|███████████████████████████████ | 160/365 [00:01<00:01, 151.22it/s] # Sim 4: 42%|████████████████████████████▏ | 145/365 [00:01<00:01, 136.75it/s] *New in version 3.0.0.* """ def __init__(self, n=1, total=1, label=None, leave=False, **kwargs): self.n = n self.total = total self.leave = leave self.desc = kwargs.pop('desc', label) self.kwargs = kwargs self.bars = [] self.make() return def make(self): for i in range(self.n): total = self.total if sc.isiterable(total): total = total[i] desc = self.desc if sc.isiterable(desc, exclude=str): desc = desc[i] else: if desc is None: desc = f'{i}' else: desc += f' {i}' bar = tqdm_pickle(total=total, position=i, desc=desc, leave=self.leave, **self.kwargs) self.bars.append(bar) return def __getitem__(self, key): # pragma: no cover return self.bars[key] def __setitem__(self, key, value): # pragma: no cover self.bars[key] = value return def update(self, index=0, amount=1): # pragma: no cover self.bars[index].update(amount) return
[docs] class capture(co.UserString, str, redirect_stdout): """ Captures stdout (e.g., from :func:`print()`) as a variable. Based on :obj:`contextlib.redirect_stdout`, but saves the user the trouble of defining and reading from an IO stream. Useful for testing the output of functions that are supposed to print certain output. **Examples**:: # Using with...as with sc.capture() as txt1: print('Assign these lines') print('to a variable') # Using start()...stop() txt2 = sc.capture().start() print('This works') print('the same way') txt2.stop() print('txt1:') print(txt1) print('txt2:') print(txt2) *New in version 1.3.3.* """ def __init__(self, seq='', *args, **kwargs): self._io = io.StringIO() self.stdout = sys.stdout co.UserString.__init__(self, seq=seq, *args, **kwargs) redirect_stdout.__init__(self, self._io) return def __enter__(self, *args, **kwargs): redirect_stdout.__enter__(self, *args, **kwargs) return self def __exit__(self, *args, **kwargs): self.data += self._io.getvalue() redirect_stdout.__exit__(self, *args, **kwargs) return def start(self): self.__enter__() return self def stop(self): self.__exit__(None, None, None) return